Compound Information | SONAR Target prediction | Name: | NERIIFOLIN | Unique Identifier: | SPE01501136 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 489.324 g/mol | X log p: | 0.998 (online calculus) | Lipinksi Failures | 0 | TPSA | 53.99 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 8 | Rotatable Bond Count: | 4 | Canonical Smiles: | COC1C(O)C(C)OC(OC2CCC3(C)C(CCC4C3CCC3(C)C(CCC43O)C3COC(=O)C=3)C2)C1O | Source: | Thevetia spp | Reference: | Arch Pharm 302: 538 (1969) | Therapeutics: | cardiotonic, antineoplastic |
Species: |
4932 |
Condition: |
AAT2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7292±0.00898026 |
Normalized OD Score: sc h |
0.9995±0.0107069 |
Z-Score: |
-0.0340±0.569616 |
p-Value: |
0.687282 |
Z-Factor: |
-18.9254 |
Fitness Defect: |
0.375 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 6|F4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.80 Celcius | Date: | 2008-04-08 YYYY-MM-DD | Plate CH Control (+): | 0.04005±0.00053 | Plate DMSO Control (-): | 0.715775±0.02450 | Plate Z-Factor: | 0.9275 |
| png ps pdf |
4457 |
4-[3-(3,5-dihydroxy-4-methoxy-6-methyl-oxan-2-yl)oxy-14-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,1 5,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
10070 |
4-[(3S,5R,10S,13R,14S,17S)-3-[(2S,5R)-3,5-dihydroxy-4-methoxy-6-methyl-oxan-2-yl]oxy-14-hydroxy-10,13-di methyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
10573 |
4-[(3R,5R,10S,13R,14S,17S)-3-[(2S,5S)-3,5-dihydroxy-4-methoxy-6-methyl-oxan-2-yl]oxy-11,14-dihydroxy-10, 13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2-on e |
10575 |
4-[(3S,5S,10R,13R,14S,17S)-3-[(2S,5S)-3,5-dihydroxy-4-methoxy-6-methyl-oxan-2-yl]oxy-5,14-dihydroxy-10,1 3-dimethyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-5H-furan-2-one |
12627 |
4-[(1R,3R,5R,10S,13R,14S,17S)-3-[(2R,5S)-3,5-dihydroxy-4-methoxy-6-methyl-oxan-2-yl]oxy-1,14-dihydroxy-1 0,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-5H-furan-2- one |
23292 |
4-[(3S,5R,10R,13R,14S,17S)-3-[(2R,5R)-3,5-dihydroxy-4-methoxy-6-methyl-oxan-2-yl]oxy-14-hydroxy-10-(hydr oxymethyl)-13-methyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-5H-f uran-2-one |
internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
active | Cluster 12609 | Additional Members: 16 | Rows returned: 4 | |
|