Compound Information | SONAR Target prediction | Name: | CYMARIN | Unique Identifier: | SPE00100698 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 504.316 g/mol | X log p: | 1.913 (online calculus) | Lipinksi Failures | 0 | TPSA | 71.06 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 9 | Rotatable Bond Count: | 5 | Canonical Smiles: | COC1CC(OC(C)C1O)OC1CCC2(C=O)C3CCC4(C)C(CCC4(O)C3CCC2(O)C1)C1COC(=O)C=1 | Class: | sterol glycoside | Source: | Apocynum, Adonis & Strophanthus spp. | Reference: | Helv Chim Acta 31: 883 (1948) |
Species: |
4932 |
Condition: |
APC9 |
Replicates: |
2 |
Raw OD Value: r im |
0.7143±0.00339411 |
Normalized OD Score: sc h |
0.9963±0.00181831 |
Z-Score: |
-0.2043±0.101862 |
p-Value: |
0.838508 |
Z-Factor: |
-25.2235 |
Fitness Defect: |
0.1761 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 2|F5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.40 Celcius | Date: | 2007-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.0412±0.00025 | Plate DMSO Control (-): | 0.69275±0.12390 | Plate Z-Factor: | 0.4147 |
| png ps pdf |
10504 |
(3S,5S)-5,14-dihydroxy-3-[(2S,4S,5R,6R)-5-hydroxy-4-methoxy-6-methyl-oxan-2-yl]oxy-13-methyl-17-(5-oxo-2 H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
222155 |
(3S,5S,8R,9S,10S,13R,14S,17S)-5,14-dihydroxy-3-(5-hydroxy-4-methoxy-6-methyl-oxan-2-yl)oxy-13-methyl-17- (5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldeh yde |
441853 |
(3S,5S,8R,9S,10S,13R,14S,17S)-5,14-dihydroxy-3-[(2S,4S,5R,6R)-5-hydroxy-4-methoxy-6-methyl-oxan-2-yl]oxy -13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren e-10-carbaldehyde |
539061 |
5,14-dihydroxy-3-(5-hydroxy-4-methoxy-6-methyl-oxan-2-yl)oxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6, 7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
3048381 |
potassium (3S,5S,8R,9S,10S,13R,14S,17S)-5,14-dihydroxy-3-[(2S,4S,5R,6R)-5-hydroxy-4-methoxy-6-methyl-oxan-2-yl]oxy -13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren e-10-carboxylate |
3048382 |
(3S,5S,8R,9S,10S,13R,14S,17S)-5,14-dihydroxy-3-[(2S,4S,5R,6R)-5-hydroxy-4-methoxy-6-methyl-oxan-2-yl]oxy -13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren e-10-carboxylic acid |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 12609 | Additional Members: 16 | Rows returned: 4 | |
|