Compound Information | SONAR Target prediction | Name: | CONVALLATOXIN | Unique Identifier: | SPE01503994 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 508.304 g/mol | X log p: | 1.723 (online calculus) | Lipinksi Failures | 0 | TPSA | 61.83 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 10 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC1OC(OC2CCC3(C=O)C4CCC5(C)C(CCC5(O)C4CCC3(O)C2)C2COC(=O)C=2)C(O)C(O)C 1O | Class: | sterol glycoside | Source: | Convallaria majalis | Reference: | Phytochemistry 13: 1805 (1974) | Therapeutics: | cardiotonic |
Species: |
4932 |
Condition: |
APC9 |
Replicates: |
2 |
Raw OD Value: r im |
0.6951±0.00353553 |
Normalized OD Score: sc h |
0.9966±0.000858167 |
Z-Score: |
-0.1825±0.0493726 |
p-Value: |
0.855272 |
Z-Factor: |
-56.388 |
Fitness Defect: |
0.1563 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|A5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.90 Celcius | Date: | 2007-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.042225±0.00072 | Plate DMSO Control (-): | 0.688175±0.02109 | Plate Z-Factor: | 0.8974 |
| png ps pdf |
2862 |
5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-(3,4,5-trihydroxy-6-methyl-oxan-2-yl)oxy-2,3,4,6,7,8 ,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
10502 |
(3S,5S,8R,9S,10S,13R,14S)-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-[(3R,4R,5S,6S)-3,4,5-trihy droxy-6-methyl-oxan-2-yl]oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-ca rbaldehyde |
12538 |
5,12,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-(3,4,5-trihydroxy-6-methyl-oxan-2-yl)oxy-2,3,4,6 ,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
20341 |
(3S,5S,10S,13R,14S,17S)-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-[(2S,5R)-3,4,5-trihydroxy-6- methyl-oxan-2-yl]oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehy de |
22346 |
(3S,5S,10S,13R,14S,17S)-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-[(2R,5R)-3,4,5-trihydroxy-6- (hydroxymethyl)oxan-2-yl]oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-ca rbaldehyde |
27411 |
(3S,5S,10S,13R,14S,17S)-5,14-dihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-3-[(2S,5R)-3,4,5-trihydroxyoxa n-2-yl]oxy-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 12609 | Additional Members: 16 | Rows returned: 4 | |
|