Compound Information | SONAR Target prediction | Name: | PERUVOSIDE | Unique Identifier: | SPE01501113 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C30H44O9 | Molecular Weight: | 505.324 g/mol | X log p: | 1.897 (online calculus) | Lipinksi Failures | 0 | TPSA | 71.06 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 9 | Rotatable Bond Count: | 5 | Canonical Smiles: | COC1C(O)C(C)OC(OC2CCC3(C=O)C(CCC4C3CCC3(C)C(CCC43O)C3COC(=O)C=3)C2)C1O | Therapeutics: | cardiotonic |
Species: |
4932 |
Condition: |
BIK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6607±0.0100409 |
Normalized OD Score: sc h |
0.9932±0.00656152 |
Z-Score: |
-0.2972±0.289882 |
p-Value: |
0.771004 |
Z-Factor: |
-10.4792 |
Fitness Defect: |
0.2601 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 19|A10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.40 Celcius | Date: | 2007-11-08 YYYY-MM-DD | Plate CH Control (+): | 0.040475±0.00139 | Plate DMSO Control (-): | 0.64005±0.13074 | Plate Z-Factor: | 0.2825 |
| png ps pdf |
4749 |
3-(3,5-dihydroxy-4-methoxy-6-methyl-oxan-2-yl)oxy-14-hydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4, 5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
14449 |
(3S,5R,10R,13R,14S,17S)-3-[(2R,5R)-3,5-dihydroxy-4-methoxy-6-methyl-oxan-2-yl]oxy-14-hydroxy-13-methyl-1 7-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-10-carb aldehyde |
58387 |
(3S,5S,10R,13R,14S,17S)-3-[(2S,5S)-3,5-dihydroxy-4-methoxy-6-methyl-oxan-2-yl]oxy-14-hydroxy-13-methyl-1 7-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-10-carb aldehyde |
189519 |
acetic acid; 3-(3,5-dihydroxy-4-methoxy-6-methyl-oxan-2-yl)oxy-14-hydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4, 5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-10-carbaldehyde |
5320498 |
3-[(2R,3S,4R,5R,6S)-3,5-dihydroxy-4-methoxy-6-methyl-oxan-2-yl]oxy-14-hydroxy-13-methyl-17-(5-oxo-2H-fur an-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-10-carboxylic acid |
5702166 |
(3S,5R,10R,13R,14S,17S)-3-[(2R,3S,4R,5S,6S)-3,5-dihydroxy-4-methoxy-6-methyl-oxan-2-yl]oxy-14-hydroxy-13 -methyl-17-(5-oxo-2H-furan-3-yl)-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren e-10-carbaldehyde |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 12609 | Additional Members: 16 | Rows returned: 4 | |
|