| Compound Information | SONAR Target prediction | | Name: | HOMIDIUM BROMIDE | | Unique Identifier: | SPE01503806 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 374.149 g/mol | | X log p: | 22.536 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 3.01 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | [BrH-].CC[n+]1c2cc(N)ccc2c2ccc(N)cc2c1c1ccccc1 | | Source: | synthetic | | Reference: | J Mol Biol 13: 269 (1965); 27: 87 (1967) | | Therapeutics: | antiprotozoal, intercalcate with DNA |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7032±0.0473762 |
| Normalized OD Score: sc h |
0.8540±0.0518231 |
| Z-Score: |
-5.8867±1.73664 |
| p-Value: |
0.00000159127 |
| Z-Factor: |
-0.379029 |
| Fitness Defect: |
13.351 |
| Bioactivity Statement: |
Outlier |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 5|D6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.60 Celcius | | Date: | 2008-08-15 YYYY-MM-DD | | Plate CH Control (+): | 0.042825±0.00077 | | Plate DMSO Control (-): | 0.715025±0.01660 | | Plate Z-Factor: | 0.9397 |
| png ps pdf |
| DBLink | Rows returned: 6 | |
| 3624 |
5-ethyl-6-phenyl-phenanthridine-3,8-diamine |
| 11765 |
5-ethyl-6-phenyl-phenanthridine-3,8-diamine chloride |
| 14710 |
5-ethyl-6-phenyl-phenanthridine-3,8-diamine bromide |
| 152350 |
5-ethyl-6-naphthalen-2-yl-phenanthridine-3,8-diamine |
| 174724 |
5-ethyl-6-phenyl-phenanthridine-3,8-diamine |
| 3896235 |
(8-amino-5-ethyl-6-phenyl-phenanthridin-3-yl)azanium |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 6881 | Additional Members: 3 | Rows returned: 2 | |
|