Compound Information | SONAR Target prediction | Name: | HOMIDIUM BROMIDE | Unique Identifier: | SPE01503806 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 374.149 g/mol | X log p: | 22.536 (online calculus) | Lipinksi Failures | 1 | TPSA | 3.01 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 2 | Canonical Smiles: | [BrH-].CC[n+]1c2cc(N)ccc2c2ccc(N)cc2c1c1ccccc1 | Source: | synthetic | Reference: | J Mol Biol 13: 269 (1965); 27: 87 (1967) | Therapeutics: | antiprotozoal, intercalcate with DNA |
Species: |
4932 |
Condition: |
BCK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6987±0.0164756 |
Normalized OD Score: sc h |
0.8207±0.00694543 |
Z-Score: |
-4.1049±0.0631366 |
p-Value: |
0.000041173 |
Z-Factor: |
0.554308 |
Fitness Defect: |
10.0977 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 5|D6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.40 Celcius | Date: | 2008-05-14 YYYY-MM-DD | Plate CH Control (+): | 0.04015±0.00098 | Plate DMSO Control (-): | 0.7044250000000001±0.02021 | Plate Z-Factor: | 0.8994 |
| png ps pdf |
DBLink | Rows returned: 6 | |
3624 |
5-ethyl-6-phenyl-phenanthridine-3,8-diamine |
11765 |
5-ethyl-6-phenyl-phenanthridine-3,8-diamine chloride |
14710 |
5-ethyl-6-phenyl-phenanthridine-3,8-diamine bromide |
152350 |
5-ethyl-6-naphthalen-2-yl-phenanthridine-3,8-diamine |
174724 |
5-ethyl-6-phenyl-phenanthridine-3,8-diamine |
3896235 |
(8-amino-5-ethyl-6-phenyl-phenanthridin-3-yl)azanium |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 6881 | Additional Members: 3 | Rows returned: 1 | |
|