| 
 | Compound Information | SONAR Target prediction |  | Name: | HOMIDIUM BROMIDE |  | Unique Identifier: | SPE01503806 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 374.149 g/mol |  | X log p: | 22.536  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 3.01 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | [BrH-].CC[n+]1c2cc(N)ccc2c2ccc(N)cc2c1c1ccccc1 |  | Source: | synthetic |  | Reference: | J Mol Biol 13: 269 (1965); 27: 87 (1967) |  | Therapeutics: | antiprotozoal, intercalcate with DNA | 
 
 
	
		| Species: | 4932 |  
		| Condition: | AAT2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7193±0.0113137 |  
		| Normalized OD Score: sc h | 0.9786±0.0108797 |  
		| Z-Score: | -1.1301±0.55266 |  
		| p-Value: | 0.294014 |  
		| Z-Factor: | -4.36152 |  
		| Fitness Defect: | 1.2241 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 5|D6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.70 Celcius |  | Date: | 2008-04-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.0402±0.00073 |  | Plate DMSO Control (-): | 0.7159±0.01647 |  | Plate Z-Factor: | 0.9139 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 6 |  | 
 
	
		| 3624 | 5-ethyl-6-phenyl-phenanthridine-3,8-diamine |  
		| 11765 | 5-ethyl-6-phenyl-phenanthridine-3,8-diamine chloride |  
		| 14710 | 5-ethyl-6-phenyl-phenanthridine-3,8-diamine bromide |  
		| 152350 | 5-ethyl-6-naphthalen-2-yl-phenanthridine-3,8-diamine |  
		| 174724 | 5-ethyl-6-phenyl-phenanthridine-3,8-diamine |  
		| 3896235 | (8-amino-5-ethyl-6-phenyl-phenanthridin-3-yl)azanium |  
 | internal high similarity DBLink  | Rows returned: 0 |  | 
 
 | active | Cluster 6881 | Additional Members: 3 | Rows returned: 2 |  | 
 
 |