Compound Information | SONAR Target prediction | Name: | PHENOLPHTHALEIN | Unique Identifier: | SPE01500480 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 304.212 g/mol | X log p: | 24.435 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 2 | Canonical Smiles: | Oc1ccc(cc1)C1(OC(=O)c2ccccc21)c1ccc(O)cc1 | Source: | synthetic | Therapeutics: | cathartic |
Species: |
4932 |
Condition: |
BEM2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6672±0.0129401 |
Normalized OD Score: sc h |
0.8260±0.00822092 |
Z-Score: |
-5.1142±0.160418 |
p-Value: |
0.000000371354 |
Z-Factor: |
0.142003 |
Fitness Defect: |
14.8061 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 16|H5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.70 Celcius | Date: | 2006-03-25 YYYY-MM-DD | Plate CH Control (+): | 0.042499999999999996±0.00193 | Plate DMSO Control (-): | 0.648925±0.01286 | Plate Z-Factor: | 0.9538 |
| png ps pdf |
DBLink | Rows returned: 4 | |
4764 |
3,3-bis(4-hydroxyphenyl)isobenzofuran-1-one |
68206 |
disodium 4-[1-(4-oxidophenyl)-3-oxo-isobenzofuran-1-yl]phenolate |
228383 |
3-(4-hydroxyphenyl)-3-phenyl-isobenzofuran-1-one |
343716 |
3-(4-hydroxyphenyl)-3H-isobenzofuran-1-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 5860 | Additional Members: 5 | Rows returned: 0 | |
|