Compound Information | SONAR Target prediction | Name: | PHENOLPHTHALEIN | Unique Identifier: | SPE01500480 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 304.212 g/mol | X log p: | 24.435 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 2 | Canonical Smiles: | Oc1ccc(cc1)C1(OC(=O)c2ccccc21)c1ccc(O)cc1 | Source: | synthetic | Therapeutics: | cathartic |
Species: |
4932 |
Condition: |
BCK1 |
Replicates: |
2 |
Raw OD Value: r im |
0.8490±0.0206475 |
Normalized OD Score: sc h |
0.9995±0.0158721 |
Z-Score: |
0.7895±0.296208 |
p-Value: |
0.439856 |
Z-Factor: |
-1.30533 |
Fitness Defect: |
0.8213 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 4|D10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.10125±0.01065 | Plate DMSO Control (-): | 0.9452499999999998±0.01954 | Plate Z-Factor: | 0.8785 |
| png ps pdf |
DBLink | Rows returned: 4 | |
4764 |
3,3-bis(4-hydroxyphenyl)isobenzofuran-1-one |
68206 |
disodium 4-[1-(4-oxidophenyl)-3-oxo-isobenzofuran-1-yl]phenolate |
228383 |
3-(4-hydroxyphenyl)-3-phenyl-isobenzofuran-1-one |
343716 |
3-(4-hydroxyphenyl)-3H-isobenzofuran-1-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 5860 | Additional Members: 5 | Rows returned: 0 | |
|