| Compound Information | SONAR Target prediction | | Name: | PHENOLPHTHALEIN | | Unique Identifier: | SPE01500480 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 304.212 g/mol | | X log p: | 24.435 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | Oc1ccc(cc1)C1(OC(=O)c2ccccc21)c1ccc(O)cc1 | | Source: | synthetic | | Therapeutics: | cathartic |
| Species: |
4932 |
| Condition: |
SWR1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5904±0.0106773 |
| Normalized OD Score: sc h |
0.8967±0.0165758 |
| Z-Score: |
-4.2415±0.707309 |
| p-Value: |
0.0000925908 |
| Z-Factor: |
-0.726059 |
| Fitness Defect: |
9.2873 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 4|H11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.60 Celcius | | Date: | 2008-01-31 YYYY-MM-DD | | Plate CH Control (+): | 0.04105±0.00065 | | Plate DMSO Control (-): | 0.629575±0.02484 | | Plate Z-Factor: | 0.8617 |
|  png
ps
pdf |
| DBLink | Rows returned: 4 | |
| 4764 |
3,3-bis(4-hydroxyphenyl)isobenzofuran-1-one |
| 68206 |
disodium 4-[1-(4-oxidophenyl)-3-oxo-isobenzofuran-1-yl]phenolate |
| 228383 |
3-(4-hydroxyphenyl)-3-phenyl-isobenzofuran-1-one |
| 343716 |
3-(4-hydroxyphenyl)-3H-isobenzofuran-1-one |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 5860 | Additional Members: 5 | Rows returned: 0 | |
|
