| Compound Information | SONAR Target prediction | | Name: | USNIC ACID | | Unique Identifier: | SPE00300147 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 328.188 g/mol | | X log p: | 1.403 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 77.51 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 7 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(=O)C1C(=O)C=C2Oc3c(C(C)=O)c(O)c(C)c(O)c3C2(C)C1=O | | Class: | benzofuran | | Source: | Usnea, Cladonia and other lichen spp | | Reference: | J Chem Soc, 1953, 603; Antibiotics I (Verlag), 1967, p 611 | | Therapeutics: | antibacterial |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.8053±0.0103945 |
| Normalized OD Score: sc h |
0.5606±0.000565496 |
| Z-Score: |
-5.1669±0.0192371 |
| p-Value: |
0.000000238624 |
| Z-Factor: |
0.454577 |
| Fitness Defect: |
15.2484 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 7|F2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 28.10 Celcius | | Date: | 2005-12-15 YYYY-MM-DD | | Plate CH Control (+): | 0.038599999999999995±0.00124 | | Plate DMSO Control (-): | 0.7806000000000001±0.01349 | | Plate Z-Factor: | 0.9474 |
|  png
ps
pdf |
| 5646 |
2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl-dibenzofuran-1,3-dione |
| 52742 |
2,6-diacetyl-7,9-dihydroxy-8-methyl-9bH-dibenzofuran-1,3-dione |
| 122718 |
(9bS)-2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl-dibenzofuran-1,3-dione |
| 169633 |
sodium 4,8-diacetyl-3-hydroxy-2,9a-dimethyl-7,9-dioxo-dibenzofuran-1-olate |
| 461310 |
(9bR)-2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl-dibenzofuran-1,3-dione |
| 726890 |
(2R,9bR)-2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl-dibenzofuran-1,3-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 2935 | Additional Members: 2 | Rows returned: 0 | |
|
