Compound Information | SONAR Target prediction | Name: | Gliquidone | Unique Identifier: | Prest1231 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C27H33N3O6S | Molecular Weight: | 494.372 g/mol | X log p: | 12.754 (online calculus) | Lipinksi Failures | 1 | TPSA | 106.2 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 9 | Rotatable Bond Count: | 9 | Canonical Smiles: | COc1ccc2c(c1)C(=O)N(CCc1ccc(cc1)S(=O)(=O)NC(=O)NC1CCCCC1)C(=O)C2(C)C |
Species: |
9606 |
Condition: |
TMPPre003 |
Replicates: |
2 |
Raw OD Value: r im |
9071.0000±0 |
Normalized OD Score: sc h |
0.7671±0 |
Z-Score: |
-6.4786±0 |
p-Value: |
0.0000000000925594 |
Z-Factor: |
-2.75132 |
Fitness Defect: |
23.1032 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 13|D2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.50 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 22091.5±7532.35178 | Plate DMSO Control (-): | 12139.5±7461.51552 | Plate Z-Factor: | -5.4357 |
| png ps pdf |
DBLink | Rows returned: 1 | |
91610 |
3-cyclohexyl-1-[4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxo-isoquinolin-2-yl)ethyl]phenyl]sulfonyl-urea |
internal high similarity DBLink | Rows returned: 0 | |
|