| Compound Information | SONAR Target prediction |
| Name: | Acetohexamide |
| Unique Identifier: | Prest3 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C15H20N2O4S |
| Molecular Weight: | 304.238 g/mol |
| X log p: | 6.772 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 76.66 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 6 |
| Rotatable Bond Count: | 6 |
| Canonical Smiles: | CC(=O)c1ccc(cc1)S(=O)(=O)NC(=O)NC1CCCCC1 |
| Generic_name: | Acetohexamide |
| Chemical_iupac_name: | 1-(4-acetylphenyl)sulfonyl-3-cyclohexyl-urea |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA448023 |
| Kegg_compound_id: | C06806 |
| Drugbank_id: | APRD00773 |
| Melting_point: | 188-190 oC |
| H2o_solubility: | 3430 mg/L |
| Logp: | 2.954 |
| Cas_registry_number: | 968-81-0 |
| Drug_category: | Hypoglycemic Agents; Sulfonylureas; ATC:A10BB31 |
| Indication: | Used in the management of diabetes mellitus type 2 (adult-onset). |
| Pharmacology: | Acetohexamide is an intermediate-acting, first-generation oral sulfonylurea. It lowers blood sugar by stimulating the pancreatic beta cells to secrete insulin and by helping the body use insulin efficiently. The pancreas must produce insulin for this medication to work. Acetohexamide has one-third the potency of chlorpropamide, and twice the potency of tolbutamide; however, similar hypoglycemic efficacy occurs with equipotent dosage of sulfonylureas. |
| Mechanism_of_action: | Sulfonylureas such as acetohexamide bind to an ATP-dependent K+ channel on the cell membrane of pancreatic beta cells. This inhibits a tonic, hyperpolarizing outflux of potassium, which causes the electric potential over the membrane to become more positive. This depolarization opens voltage-gated Ca2+ channels. The rise in intracellular calcium leads to increased fusion of insulin granulae with the cell membrane, and therefore increased secretion of (pro)insulin. |
| Organisms_affected: | Humans and other mammals |
| Found: 3 nonactive as graph: single | with analogs | 1 2 3 Next >> |
| Species: | 9606 |
| Condition: | TMPPre001 |
| Replicates: | 2 |
| Raw OD Value: r im | 2109.0000±0 |
| Normalized OD Score: sc h | 1.0146±0 |
| Z-Score: | 0.3291±0 |
| p-Value: | 0.742104 |
| Z-Factor: | -6.48492 |
| Fitness Defect: | 0.2983 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 1989 | 1-(4-acetylphenyl)sulfonyl-3-cyclohexyl-urea |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 5012 | Additional Members: 11 | Rows returned: 1 |
| Prest1231 | 0.48936170212766 |
Service provided by the
Mike Tyers Laboratory