| Compound Information | SONAR Target prediction | | Name: | Gliquidone | | Unique Identifier: | Prest1231 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C27H33N3O6S | | Molecular Weight: | 494.372 g/mol | | X log p: | 12.754 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 106.2 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 9 | | Rotatable Bond Count: | 9 | | Canonical Smiles: | COc1ccc2c(c1)C(=O)N(CCc1ccc(cc1)S(=O)(=O)NC(=O)NC1CCCCC1)C(=O)C2(C)C |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
706.0000±0 |
| Normalized OD Score: sc h |
0.7600±0 |
| Z-Score: |
-5.4099±0 |
| p-Value: |
0.0000000630674 |
| Z-Factor: |
-2.75377 |
| Fitness Defect: |
16.5791 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 13|D2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.50 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 727.5±605.08760 | | Plate DMSO Control (-): | 773±261.27974 | | Plate Z-Factor: | -83.4256 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 91610 |
3-cyclohexyl-1-[4-[2-(7-methoxy-4,4-dimethyl-1,3-dioxo-isoquinolin-2-yl)ethyl]phenyl]sulfonyl-urea |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 5012 | Additional Members: 11 | Rows returned: 0 | |
|
