| Compound Information | SONAR Target prediction |
| Name: | Glimepiride |
| Unique Identifier: | Prest54 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C24H34N4O5S |
| Molecular Weight: | 456.347 g/mol |
| X log p: | 6.855 (online calculus) |
| Lipinksi Failures | 2 |
| TPSA | 96.97 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 9 |
| Rotatable Bond Count: | 11 |
| Canonical Smiles: | CCC1=C(C)CN(C(=O)NCCc2ccc(cc2)S(=O)(=O)NC(=O)NC2CCC(C)CC2)C1=O |
| Generic_name: | Glimepiride |
| Chemical_iupac_name: | 3-ethyl-N,N-bis(3-ethyl-4-methyl-2-oxo-5H-pyrrol-2-yl)-4-methyl-2-oxo-5H-pyrrole-1-c arboxamide |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA449761 |
| Kegg_compound_id: | C07669 |
| Drugbank_id: | APRD00381 |
| Melting_point: | 207 oC |
| H2o_solubility: | Insoluble |
| Logp: | 3.306 |
| Cas_registry_number: | 93479-97-1 |
| Drug_category: | Immunosuppressive Agents; Hypoglycemic Agents; Antiarrhythmic Agents; Sulfonylureas; ATC:A10BB12 |
| Indication: | For concomitant use with insulin for the treatment of noninsulin-dependent (Type II) diabetes mellitus; For the treatment ofhyperglycemia that cannot be controlled by diet and exercise in conjunction with an oral hypoglycemic agent |
| Pharmacology: | Glimepiride, like glyburide and glipizide, is a "second-generation" sulfonylurea agents. Glimepiride is used with diet to lower blood glucose by increasing the secretion of insulin from pancreas and increasing the sensitivity of peripheral tissues to insulin. |
| Mechanism_of_action: | The mechanism of action of glimepiride in lowering blood glucose appears to be dependent on stimulating the release of insulin from functioning pancreatic beta cells, and increasing sensitivity of peripheral tissues to insulin. Glimepiride likely binds to ATP-sensitive potassium channel receptors on the pancreatic cell surface, reducing potassium conductance and causing depolarization of the membrane. Membrane depolarization stimulates calcium ion influx through voltage-sensitive calcium channels. This increase in intracellular calcium ion concentration induces the secretion of insulin. |
| Organisms_affected: | Humans and other mammals |
| Found: 3 nonactive as graph: single | with analogs | 1 2 3 Next >> |
| Species: | 9606 |
| Condition: | TMPPre001 |
| Replicates: | 2 |
| Raw OD Value: r im | 1934.0000±0 |
| Normalized OD Score: sc h | 0.9711±0 |
| Z-Score: | -0.6524±0 |
| p-Value: | 0.514116 |
| Z-Factor: | -12.8882 |
| Fitness Defect: | 0.6653 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 1 |
| 3476 | 3-ethyl-4-methyl-N-[2-[4-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-2-oxo-5H-pyrrole-1-carbox amide |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 5012 | Additional Members: 11 | Rows returned: 1 |
| Prest1231 | 0.48936170212766 |
Service provided by the
Mike Tyers Laboratory