| Compound Information | SONAR Target prediction |
| Name: | Artemisinin |
| Unique Identifier: | LAT001H11 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C15H22O5 |
| Molecular Weight: | 260.158 g/mol |
| X log p: | -0.127 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 53.99 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 0 |
| Canonical Smiles: | CC1CCC2C(C)C(=O)OC3OC4(C)CCC1C32OO4 |
| Found: 5 active as graph: single | with analogs | << Back 1 2 3 4 5 |
| Species: | 4932 |
| Condition: | wt24h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.7198±0.00410122 |
| Normalized OD Score: sc h | 0.8862±0.00412365 |
| Z-Score: | -4.9693±1.44182 |
| p-Value: | 0.0000391204 |
| Z-Factor: | 0.500169 |
| Fitness Defect: | 10.1489 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 52 | << Back 1 2 3 4 5 6 7 8 9 Next >> |
| 540565 |
| 637452 |
| 641602 |
| 821423 |
| 5320405 |
| 5458876 |
| internal high similarity DBLink | Rows returned: 3 |
| BIOMOL 22 | 1.0000 |
| Prest818 | 1.0000 |
| SPE01503042 | 1.0000 |
| active | Cluster 4356 | Additional Members: 5 | Rows returned: 1 |
| SPE01503042 | 0 |
Service provided by the
Mike Tyers Laboratory