| Compound Information | SONAR Target prediction |
| Name: | Artemisinin |
| Unique Identifier: | Prest818 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C15H22O5 |
| Molecular Weight: | 263.181 g/mol |
| X log p: | -0.183 (online calculus) |
| Lipinksi Failures | 0 |
| TPSA | 53.99 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 0 |
| Canonical Smiles: | CC1CCC2C(C)C(=O)OC3OC4(C)CCC1C32OO4 |
| Found: 3 nonactive as graph: single | with analogs | 1 2 3 Next >> |
| Species: | 9606 |
| Condition: | TMPPre001 |
| Replicates: | 2 |
| Raw OD Value: r im | 1998.0000±0 |
| Normalized OD Score: sc h | 1.0048±0 |
| Z-Score: | 0.1071±0 |
| p-Value: | 0.914718 |
| Z-Factor: | -6.22135 |
| Fitness Defect: | 0.0891 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 15 | 1 2 3 Next >> |
| 2240 |
| 68827 |
| 452191 |
| 536982 |
| 537065 |
| 537182 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 4356 | Additional Members: 5 | Rows returned: 2 |
| LAT001H11 | 0 |
| SPE01503042 | 0 |
Service provided by the
Mike Tyers Laboratory