| Compound Information | SONAR Target prediction |
| Name: | TENIPOSIDE |
| Unique Identifier: | SPE01504094 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 624.401 g/mol |
| X log p: | 16.146 (online calculus) |
| Lipinksi Failures | 2 |
| TPSA | 125.44 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 13 |
| Rotatable Bond Count: | 6 |
| Canonical Smiles: | COc1cc(cc(OC)c1O)C1C2C(COC2=O)C(OC2OC3COC(OC3C(O)C2O)c2sccc2)c2cc3OCOc 3cc12 |
| Source: | semisynthetic |
| Therapeutics: | antineoplastic |
| Generic_name: | Teniposide |
| Drug_type: | Approved Drug |
| Kegg_compound_id: | C11153 |
| Drugbank_id: | APRD00649 |
| Logp: | 1.963 |
| Cas_registry_number: | 29767-20-2 |
| Drug_category: | Antineoplastic Agents; ATC:L01CB02 |
| Indication: | Treatment of refractory acute lymphoblastic leukaemia |
| Pharmacology: | Teniposide is a phase-specific cytotoxic drug, acting in the late S or early G 2 phase of the cell cycle, thus preventing cells from entering mitosis. Teniposide causes dose-dependent single- and double-stranded breaks in DNA and DNA: protein cross-links. The mechanism of action appears to be related to the inhibition of type II topoisomerase activity since teniposide does not intercalate into DNA or bind strongly to DNA. |
| Mechanism_of_action: | Binds to and inhibits DNA topoisomerase II. The cytotoxic effects of teniposide are related to the relative number of double-stranded DNA breaks produced in cells, which are a reflection of the stabilization of a topoisomerase II-DNA intermediate. |
| Organisms_affected: | Humans and other mammals |
| Found: 205 nonactive as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> [205] |
| Species: | 4932 |
| Condition: | BCK1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.8895±0.0127986 |
| Normalized OD Score: sc h | 0.9957±0.00469564 |
| Z-Score: | -0.1746±0.0948488 |
| p-Value: | 0.861712 |
| Z-Factor: | -8.01161 |
| Fitness Defect: | 0.1488 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 8 | 1 2 Next >> |
| 5396 |
| 34698 |
| 107642 |
| 275784 |
| 452548 |
| 4475882 |
| internal high similarity DBLink | Rows returned: 1 |
| SPE01500903 | 0.9017 |
| active | Cluster 2906 | Additional Members: 14 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory