Compound Information | SONAR Target prediction | Name: | EMODIC ACID | Unique Identifier: | SPE01504060 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H8O7 | Molecular Weight: | 292.156 g/mol | X log p: | 6.925 (online calculus) | Lipinksi Failures | 1 | TPSA | 51.21 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 7 | Rotatable Bond Count: | 1 | Canonical Smiles: | OC(=O)c1cc(O)c2c(=O)c3c(O)cc(O)cc3c(=O)c2c1 | Source: | ex Penicillium cyclopium, Calopaca ferruginea | Reference: | Helv Chim Acta 8: 126 (1925); Biochem J 34: 159 (1940) | Therapeutics: | cathartic, purgative |
Species: |
4932 |
Condition: |
ARP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6994±0.00339411 |
Normalized OD Score: sc h |
0.9572±0.00137365 |
Z-Score: |
-2.1640±0.234686 |
p-Value: |
0.0327592 |
Z-Factor: |
-0.0621868 |
Fitness Defect: |
3.4186 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 9|A4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.80 Celcius | Date: | 2006-03-23 YYYY-MM-DD | Plate CH Control (+): | 0.039825±0.00165 | Plate DMSO Control (-): | 0.7226250000000001±0.00953 | Plate Z-Factor: | 0.9427 |
| png ps pdf |
DBLink | Rows returned: 1 | |
10169 |
4,5,7-trihydroxy-9,10-dioxo-anthracene-1-carboxylic acid |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1535 | Additional Members: 5 | Rows returned: 3 | |
|