Compound Information | SONAR Target prediction | Name: | PHYSCION | Unique Identifier: | SPE01504070 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 272.168 g/mol | X log p: | 8.14 (online calculus) | Lipinksi Failures | 1 | TPSA | 43.37 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 1 | Canonical Smiles: | COc1cc(O)c2c(=O)c3c(O)cc(C)cc3c(=O)c2c1 | Class: | anthraquinone | Source: | Xanthoria lichens, Rumex spp and various Aspergillus spp. | Reference: | Helv Chim Acta 8: 140 (1925); Pharmacology 14: 1 (1976) | Therapeutics: | antibacterial, cathartic |
Species: |
4932 |
Condition: |
RGP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.3546±0.0046669 |
Normalized OD Score: sc h |
0.7596±0.0103254 |
Z-Score: |
-6.2776±0.354388 |
p-Value: |
0.000000000868306 |
Z-Factor: |
0.318888 |
Fitness Defect: |
20.8645 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 16|E7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.40 Celcius | Date: | 2008-06-26 YYYY-MM-DD | Plate CH Control (+): | 0.040425±0.00053 | Plate DMSO Control (-): | 0.458625±0.01980 | Plate Z-Factor: | 0.8648 |
| png ps pdf |
DBLink | Rows returned: 1 | |
10639 |
1,8-dihydroxy-6-methoxy-3-methyl-anthracene-9,10-dione |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1535 | Additional Members: 5 | Rows returned: 3 | |
|