| Compound Information | SONAR Target prediction |  | Name: | HOMIDIUM BROMIDE |  | Unique Identifier: | SPE01503806  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 374.149 g/mol |  | X log p: | 22.536  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 3.01 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | [BrH-].CC[n+]1c2cc(N)ccc2c2ccc(N)cc2c1c1ccccc1 |  | Source: | synthetic |  | Reference: | J Mol Biol 13: 269 (1965); 27: 87 (1967) |  | Therapeutics: | antiprotozoal, intercalcate with DNA |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		VPS35 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6762±0.00431335 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9487±0.00383885 | 
	 
	
		| Z-Score: | 
		-2.5788±0.241575 | 
	 
	
		| p-Value: | 
		0.011003 | 
	 
	
		| Z-Factor: | 
		-0.705535 | 
	 
	
		| Fitness Defect: | 
		4.5096 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 5|D6 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 29.80 Celcius |  | Date: | 2008-02-20 YYYY-MM-DD |  | Plate CH Control (+): | 0.04155±0.00078 |  | Plate DMSO Control (-): | 0.6962250000000001±0.01634 |  | Plate Z-Factor: | 0.9133 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 6 |  |  
 
	
		| 3624 | 
		5-ethyl-6-phenyl-phenanthridine-3,8-diamine | 
	 
	
		| 11765 | 
		5-ethyl-6-phenyl-phenanthridine-3,8-diamine chloride | 
	 
	
		| 14710 | 
		5-ethyl-6-phenyl-phenanthridine-3,8-diamine bromide | 
	 
	
		| 152350 | 
		5-ethyl-6-naphthalen-2-yl-phenanthridine-3,8-diamine | 
	 
	
		| 174724 | 
		5-ethyl-6-phenyl-phenanthridine-3,8-diamine | 
	 
	
		| 3896235 | 
		(8-amino-5-ethyl-6-phenyl-phenanthridin-3-yl)azanium | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 6881 | Additional Members: 3 | Rows returned: 2 |  |   
 
 |