Compound Information | SONAR Target prediction | Name: | HOMIDIUM BROMIDE | Unique Identifier: | SPE01503806 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 374.149 g/mol | X log p: | 22.536 (online calculus) | Lipinksi Failures | 1 | TPSA | 3.01 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 2 | Canonical Smiles: | [BrH-].CC[n+]1c2cc(N)ccc2c2ccc(N)cc2c1c1ccccc1 | Source: | synthetic | Reference: | J Mol Biol 13: 269 (1965); 27: 87 (1967) | Therapeutics: | antiprotozoal, intercalcate with DNA |
Species: |
4932 |
Condition: |
SUR2 |
Replicates: |
2 |
Raw OD Value: r im |
0.7008±0.00707107 |
Normalized OD Score: sc h |
0.9543±0.00610393 |
Z-Score: |
-2.3141±0.355472 |
p-Value: |
0.0247228 |
Z-Factor: |
-0.800311 |
Fitness Defect: |
3.7 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 5|D6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.90 Celcius | Date: | 2008-05-06 YYYY-MM-DD | Plate CH Control (+): | 0.040675±0.00375 | Plate DMSO Control (-): | 0.7160000000000001±0.01537 | Plate Z-Factor: | 0.9286 |
| png ps pdf |
DBLink | Rows returned: 6 | |
3624 |
5-ethyl-6-phenyl-phenanthridine-3,8-diamine |
11765 |
5-ethyl-6-phenyl-phenanthridine-3,8-diamine chloride |
14710 |
5-ethyl-6-phenyl-phenanthridine-3,8-diamine bromide |
152350 |
5-ethyl-6-naphthalen-2-yl-phenanthridine-3,8-diamine |
174724 |
5-ethyl-6-phenyl-phenanthridine-3,8-diamine |
3896235 |
(8-amino-5-ethyl-6-phenyl-phenanthridin-3-yl)azanium |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 6881 | Additional Members: 3 | Rows returned: 2 | |
|