| Compound Information | SONAR Target prediction | | Name: | THALIDOMIDE | | Unique Identifier: | SPE01503607 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 248.15 g/mol | | X log p: | 6.737 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 71.52 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | O=C1CCC(n2c(=O)c3ccccc3c2=O)C(=O)N1 | | Source: | synthetic | | Therapeutics: | hypnotic |
| Species: |
4932 |
| Condition: |
AAT2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7163±0.00311127 |
| Normalized OD Score: sc h |
1.0015±0.00177568 |
| Z-Score: |
0.0803±0.0928006 |
| p-Value: |
0.936098 |
| Z-Factor: |
-7.58493 |
| Fitness Defect: |
0.066 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 17|C9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.90 Celcius | | Date: | 2008-04-08 YYYY-MM-DD | | Plate CH Control (+): | 0.03985±0.00085 | | Plate DMSO Control (-): | 0.7016499999999999±0.00997 | | Plate Z-Factor: | 0.9413 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 5426 |
2-(2,6-dioxo-3-piperidyl)isoindole-1,3-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 7702 | Additional Members: 4 | Rows returned: 2 | |
|