| Compound Information | SONAR Target prediction | | Name: | Thalidomide | | Unique Identifier: | Prest463 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C13H10N2O4 | | Molecular Weight: | 248.15 g/mol | | X log p: | 6.737 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 71.52 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | O=C1CCC(n2c(=O)c3ccccc3c2=O)C(=O)N1 |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
2013.0000±0 |
| Normalized OD Score: sc h |
0.9643±0 |
| Z-Score: |
-0.8052±0 |
| p-Value: |
0.420684 |
| Z-Factor: |
-13.8454 |
| Fitness Defect: |
0.8659 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 3|D3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.60 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 1037.5±978.23463 | | Plate DMSO Control (-): | 2014±552.18250 | | Plate Z-Factor: | -4.9321 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 5426 |
2-(2,6-dioxo-3-piperidyl)isoindole-1,3-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 7702 | Additional Members: 4 | Rows returned: 0 | |
|
