| Compound Information | SONAR Target prediction | | Name: | THALIDOMIDE | | Unique Identifier: | SPE01503607 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 248.15 g/mol | | X log p: | 6.737 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 71.52 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | O=C1CCC(n2c(=O)c3ccccc3c2=O)C(=O)N1 | | Source: | synthetic | | Therapeutics: | hypnotic |
| Species: |
4932 |
| Condition: |
BRE1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4363±0.0144957 |
| Normalized OD Score: sc h |
1.0103±0.00592794 |
| Z-Score: |
0.1882±0.115901 |
| p-Value: |
0.851186 |
| Z-Factor: |
-81.1345 |
| Fitness Defect: |
0.1611 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 23|E7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.30 Celcius | | Date: | 2006-03-16 YYYY-MM-DD | | Plate CH Control (+): | 0.039375±0.00133 | | Plate DMSO Control (-): | 0.417±0.02345 | | Plate Z-Factor: | 0.7974 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 5426 |
2-(2,6-dioxo-3-piperidyl)isoindole-1,3-dione |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 7702 | Additional Members: 4 | Rows returned: 2 | |
|