| Compound Information | SONAR Target prediction | | Name: | RESVERATROL | | Unique Identifier: | SPE01502223 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 216.148 g/mol | | X log p: | 19.059 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | Oc1ccc(cc1)C=Cc1cc(O)cc(O)c1 | | Class: | stilbene | | Source: | Veratrum grandiflorum, Pinus sibirica, Vitis vinifera, Arachis hypogaea | | Reference: | Aust J Chem 24:2427 (1971); Tet Lett 1972:2965; Phytochemistry 13:633 (1974);
15:1791, 2006 (1976); 32:1083 (1993) | | Therapeutics: | antifungal, antibacterial | | Generic_name: | RESVERATROL | | Chemical_iupac_name: | RESVERATROL | | Drug_type: | Experimental | | Kegg_compound_id: | C03582 | | Drugbank_id: | EXPT02968 | | Logp: | 3.316 | | Cas_registry_number: | 501-36-0 | | Drug_category: | Nrh Dehydrogenase [Quinone] 2 inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
SLT2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6824±0.0397394 |
| Normalized OD Score: sc h |
0.8921±0.0569575 |
| Z-Score: |
-5.3279±2.82027 |
| p-Value: |
0.000428584 |
| Z-Factor: |
-0.933983 |
| Fitness Defect: |
7.755 |
| Bioactivity Statement: |
Outlier |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 8|F7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.10 Celcius | | Date: | 2006-03-21 YYYY-MM-DD | | Plate CH Control (+): | 0.038400000000000004±0.00100 | | Plate DMSO Control (-): | 0.7422000000000001±0.01057 | | Plate Z-Factor: | 0.9651 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 5056 |
5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| 445154 |
5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| 1548910 |
5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 1910 | Additional Members: 8 | Rows returned: 4 | |
|
