Compound Information | SONAR Target prediction | Name: | RESVERATROL | Unique Identifier: | SPE01502223 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 216.148 g/mol | X log p: | 19.059 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 2 | Canonical Smiles: | Oc1ccc(cc1)C=Cc1cc(O)cc(O)c1 | Class: | stilbene | Source: | Veratrum grandiflorum, Pinus sibirica, Vitis vinifera, Arachis hypogaea | Reference: | Aust J Chem 24:2427 (1971); Tet Lett 1972:2965; Phytochemistry 13:633 (1974); 15:1791, 2006 (1976); 32:1083 (1993) | Therapeutics: | antifungal, antibacterial | Generic_name: | RESVERATROL | Chemical_iupac_name: | RESVERATROL | Drug_type: | Experimental | Kegg_compound_id: | C03582 | Drugbank_id: | EXPT02968 | Logp: | 3.316 | Cas_registry_number: | 501-36-0 | Drug_category: | Nrh Dehydrogenase [Quinone] 2 inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SPE01502260 |
Replicates: |
2 |
Raw OD Value: r im |
0.6564±0 |
Normalized OD Score: sc h |
0.9704±0 |
Z-Score: |
-0.2654±0 |
p-Value: |
0.790706 |
Z-Factor: |
-2.26746 |
Fitness Defect: |
0.2348 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SpectrumTMP | Plate Number and Position: | 2|E5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 0.00 Celcius | Date: | 2006-08-13 YYYY-MM-DD | Plate CH Control (+): | 0.04105±0.00083 | Plate DMSO Control (-): | 0.69785±0.01911 | Plate Z-Factor: | 0.9085 |
| png ps pdf |
DBLink | Rows returned: 3 | |
5056 |
5-[2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
445154 |
5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
1548910 |
5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 1910 | Additional Members: 8 | Rows returned: 4 | |
|