| Compound Information | SONAR Target prediction | | Name: | ESTRONE ACETATE | | Unique Identifier: | SPE01501181 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 288.212 g/mol | | X log p: | 6.162 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 43.37 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | CC(=O)Oc1ccc2C3CCC4(C)C(CCC4=O)C3CCc2c1 | | Source: | semisynthetic | | Therapeutics: | estrogen |
| Species: |
4932 |
| Condition: |
RGP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3621±0.00777817 |
| Normalized OD Score: sc h |
0.8076±0.0116055 |
| Z-Score: |
-5.0263±0.369991 |
| p-Value: |
0.00000100766 |
| Z-Factor: |
0.232825 |
| Fitness Defect: |
13.8079 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 1|G3 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.00 Celcius | | Date: | 2008-06-26 YYYY-MM-DD | | Plate CH Control (+): | 0.04045±0.00044 | | Plate DMSO Control (-): | 0.41855±0.01536 | | Plate Z-Factor: | 0.8554 |
|  png
ps
pdf |
| DBLink | Rows returned: 5 | |
| 3273 |
(13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl) acetate |
| 92846 |
[(8S,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]
acetate |
| 636639 |
[(8S,9S,13R,14R)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]
acetate |
| 6710671 |
[(13S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
| 6918971 |
[(8S,9R,13S,14R)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]
acetate |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 13348 | Additional Members: 15 | Rows returned: 2 | |
|
