| Compound Information | SONAR Target prediction | | Name: | PREGNENOLONE | | Unique Identifier: | SPE01500645 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 284.224 g/mol | | X log p: | 1.745 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC(=O)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C | | Source: | semisynthetic | | Therapeutics: | glucocortcoid, antiinflammatory | | Generic_name: | 3-BETA-HYDROXY-5-ANDROSTEN-17-ONE | | Chemical_iupac_name: | 3-BETA-HYDROXY-5-ANDROSTEN-17-ONE | | Drug_type: | Experimental | | Drugbank_id: | EXPT00519 | | Logp: | 3.73 | | Drug_category: | Isomerase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
ARL3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5868±0.0053033 |
| Normalized OD Score: sc h |
0.9028±0.00340319 |
| Z-Score: |
-4.5895±0.333869 |
| p-Value: |
0.00000740066 |
| Z-Factor: |
0.0221461 |
| Fitness Defect: |
11.8139 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 3|F8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.10 Celcius | | Date: | 2008-06-11 YYYY-MM-DD | | Plate CH Control (+): | 0.0402±0.00051 | | Plate DMSO Control (-): | 0.65265±0.01901 | | Plate Z-Factor: | 0.9047 |
|  png
ps
pdf |
| 3401651 |
3-hydroxy-10,13-dimethyl-16-propan-2-yl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren
-17-one |
| 3408999 |
6-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)
heptan-3-one |
| 3411907 |
3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
| 3553248 |
(17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)oxi
danium |
| 3830292 |
1-(3-hydroxy-10,13,16,17-tetramethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17
-yl)ethanone |
| 4367012 |
16-cyclohexyl-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-
17-one |
| internal high similarity DBLink | Rows returned: 3 | |
| nonactive | Cluster 7902 | Additional Members: 9 | Rows returned: 6 | |
|
