| Compound Information | SONAR Target prediction | | Name: | PREGNENOLONE | | Unique Identifier: | SPE01500645 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 284.224 g/mol | | X log p: | 1.745 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC(=O)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C | | Source: | semisynthetic | | Therapeutics: | glucocortcoid, antiinflammatory | | Generic_name: | 3-BETA-HYDROXY-5-ANDROSTEN-17-ONE | | Chemical_iupac_name: | 3-BETA-HYDROXY-5-ANDROSTEN-17-ONE | | Drug_type: | Experimental | | Drugbank_id: | EXPT00519 | | Logp: | 3.73 | | Drug_category: | Isomerase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
BCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5165±0.019304 |
| Normalized OD Score: sc h |
0.7536±0.00793179 |
| Z-Score: |
-4.8137±0.069877 |
| p-Value: |
0.00000152536 |
| Z-Factor: |
0.370989 |
| Fitness Defect: |
13.3933 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 19|D8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.40 Celcius | | Date: | 2006-03-24 YYYY-MM-DD | | Plate CH Control (+): | 0.0379±0.00136 | | Plate DMSO Control (-): | 0.6738500000000001±0.02823 | | Plate Z-Factor: | 0.8473 |
| png ps pdf |
| 257632 |
1-(3-hydroxy-6,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17- yl)ethanone |
| 288137 |
6-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) heptan-2-one |
| 312777 |
6-[(3R,8R,10S,13S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]ph enanthren-17-yl]heptan-2-one |
| 313764 |
3-hydroxy-13-methyl-2,3,4,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-one |
| 351779 |
2-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl) -6-methyl-heptan-3-one |
| 439611 |
1-[(3S,8S,9S,10R,13R,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopen ta[a]phenanthren-17-yl]ethanone |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 7902 | Additional Members: 9 | Rows returned: 3 | |
|