Compound Information | SONAR Target prediction | Name: | URSODIOL | Unique Identifier: | SPE01500605 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 353.262 g/mol | X log p: | -0.613 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(CCC(O)=O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C | Class: | sterol | Source: | bear bile | Reference: | Hoppe Seyler-s Z Physiol Chem 244:181 (1936); Drugs 21:90 (1981); Gastroenterology 91:1007 (1986) | Therapeutics: | anticholelithogenic; LD50(rat) 890 mg/kg ip | Generic_name: | CHOLIC ACID | Chemical_iupac_name: | CHOLIC ACID | Drug_type: | Experimental | Kegg_compound_id: | C00695 | Drugbank_id: | EXPT00906 | Logp: | 2.818 | Cas_registry_number: | 81-25-4 | Drug_category: | Estrogen-Related Receptor Gamma inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
BY4741 |
Replicates: |
2 |
Raw OD Value: r im |
0.7270±0.00813173 |
Normalized OD Score: sc h |
0.9692±0.00927675 |
Z-Score: |
-0.2516±0.393487 |
p-Value: |
0.787486 |
Z-Factor: |
-52.0285 |
Fitness Defect: |
0.2389 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum_ED | Plate Number and Position: | 2|D5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 595 nm | Robot Temperature: | 30.00 Celcius | Date: | 2010-08-10 YYYY-MM-DD | Plate CH Control (+): | 0.083±0.00644 | Plate DMSO Control (-): | 0.9722500000000002±0.02792 | Plate Z-Factor: | 0.9122 |
| png ps pdf |
5315844 |
4-[(5S,8R,10S,13R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H- cyclopenta[a]phenanthren-17-yl]pentanoic acid |
5316059 |
2-methyl-6-[(5S,10S,13R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahyd ro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
5317409 |
4-[(10R,13R,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclop enta[a]phenanthren-17-yl]pentanoic acid |
5322050 |
2,3-dimethyl-6-[(5S,10S,13R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradec ahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
5322053 |
2-methyl-6-[(5S,10S)-3,7,12-trihydroxy-10-methyl-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyc lopenta[a]phenanthren-17-yl]heptanoic acid |
5460314 |
(4R)-4-[(3R,5S,7R,8R,9S,10S,12S,13R,14S,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,1 5,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
internal high similarity DBLink | Rows returned: 31 | 1 2 3 4 5 6 Next >> |
active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 | |
|