Compound Information | SONAR Target prediction | Name: | CLOMIPHENE CITRATE | Unique Identifier: | SPE01500196 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 561.797 g/mol | X log p: | 30.354 (online calculus) | Lipinksi Failures | 1 | TPSA | 12.47 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 9 | Canonical Smiles: | CCN(CC)CCOc1ccc(cc1)C(=C(Cl)c1ccccc1)c1ccccc1.OC(=O)CC(O)(CC(O)=O)C(O) =O | Source: | synthetic | Therapeutics: | gonad stimulating principle |
Species: |
4932 |
Condition: |
HSC82 |
Replicates: |
2 |
Raw OD Value: r im |
0.0710±0.00643467 |
Normalized OD Score: sc h |
0.0981±0.00887738 |
Z-Score: |
-50.2521±3.5878 |
p-Value: |
0 |
Z-Factor: |
0.909891 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 5|D7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.20 Celcius | Date: | 2008-04-29 YYYY-MM-DD | Plate CH Control (+): | 0.04065±0.00077 | Plate DMSO Control (-): | 0.71015±0.01292 | Plate Z-Factor: | 0.9369 |
| png ps pdf |
DBLink | Rows returned: 3 | |
60974 |
2-[4-(2-chloro-1,2-diphenyl-ethenyl)phenoxy]-N,N-diethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
3033832 |
2-[4-[(E)-2-chloro-1,2-diphenyl-ethenyl]phenoxy]-N,N-diethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
6420009 |
2-[4-[(E)-2-chloro-1,2-diphenyl-ethenyl]phenoxy]-N,N-diethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 3471 | Additional Members: 6 | Rows returned: 5 | |
|