| Compound Information | SONAR Target prediction | | Name: | Tamoxifen citrate | | Unique Identifier: | Prest458 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C32H37NO8 | | Molecular Weight: | 526.344 g/mol | | X log p: | 30.746 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 12.47 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 8 | | Canonical Smiles: | CCC(c1ccccc1)=C(c1ccccc1)c1ccc(OCCN(C)C)cc1.OC(=O)CC(O)(CC(O)=O)C(O)=O |
| Species: |
9606 |
| Condition: |
TMPPre001 |
| Replicates: |
2 |
| Raw OD Value: r im |
1868.0000±0 |
| Normalized OD Score: sc h |
0.9337±0 |
| Z-Score: |
-1.4951±0 |
| p-Value: |
0.134877 |
| Z-Factor: |
-29.6545 |
| Fitness Defect: |
2.0034 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Prestwick | | Plate Number and Position: | 2|G7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 0 nm | | Robot Temperature: | 23.40 Celcius | | Date: | 2006-10-10 YYYY-MM-DD | | Plate CH Control (+): | 979±955.64442 | | Plate DMSO Control (-): | 1983.5±536.09994 | | Plate Z-Factor: | -4.7841 |
|  png
ps
pdf |
| DBLink | Rows returned: 3 | |
| 23672 |
2-[4-(1,2-diphenylbut-1-enyl)phenoxy]-N,N-dimethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
| 2733525 |
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic
acid |
| 3033630 |
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic
acid |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 3471 | Additional Members: 6 | Rows returned: 4 | |
|
