Compound Information | SONAR Target prediction | Name: | Tamoxifen citrate | Unique Identifier: | Prest458 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C32H37NO8 | Molecular Weight: | 526.344 g/mol | X log p: | 30.746 (online calculus) | Lipinksi Failures | 1 | TPSA | 12.47 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 8 | Canonical Smiles: | CCC(c1ccccc1)=C(c1ccccc1)c1ccc(OCCN(C)C)cc1.OC(=O)CC(O)(CC(O)=O)C(O)=O |
Species: |
9606 |
Condition: |
TMPPre001 |
Replicates: |
2 |
Raw OD Value: r im |
1868.0000±0 |
Normalized OD Score: sc h |
0.9337±0 |
Z-Score: |
-1.4951±0 |
p-Value: |
0.134877 |
Z-Factor: |
-29.6545 |
Fitness Defect: |
2.0034 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Prestwick | Plate Number and Position: | 2|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 0 nm | Robot Temperature: | 23.40 Celcius | Date: | 2006-10-10 YYYY-MM-DD | Plate CH Control (+): | 979±955.64442 | Plate DMSO Control (-): | 1983.5±536.09994 | Plate Z-Factor: | -4.7841 |
| png ps pdf |
DBLink | Rows returned: 3 | |
23672 |
2-[4-(1,2-diphenylbut-1-enyl)phenoxy]-N,N-dimethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
2733525 |
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
3033630 |
2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 3471 | Additional Members: 6 | Rows returned: 5 | |
|