| Compound Information | SONAR Target prediction |  | Name: | Tamoxifen citrate |  | Unique Identifier: | Prest458  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C32H37NO8 |  | Molecular Weight: | 526.344 g/mol |  | X log p: | 30.746  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 12.47 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 8 |  | Canonical Smiles: | CCC(c1ccccc1)=C(c1ccccc1)c1ccc(OCCN(C)C)cc1.OC(=O)CC(O)(CC(O)=O)C(O)=O |  
 
 
	
		| Species: | 
		9606 | 
	 
	
		| Condition: | 
		TMPPre001 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		1868.0000±0 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9337±0 | 
	 
	
		| Z-Score: | 
		-1.4951±0 | 
	 
	
		| p-Value: | 
		0.134877 | 
	 
	
		| Z-Factor: | 
		-29.6545 | 
	 
	
		| Fitness Defect: | 
		2.0034 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Prestwick |  | Plate Number and Position: | 2|G7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 0 nm |  | Robot Temperature: | 23.40 Celcius |  | Date: | 2006-10-10 YYYY-MM-DD |  | Plate CH Control (+): | 979±955.64442 |  | Plate DMSO Control (-): | 1983.5±536.09994 |  | Plate Z-Factor: | -4.7841 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 23672 | 
		2-[4-(1,2-diphenylbut-1-enyl)phenoxy]-N,N-dimethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid | 
	 
	
		| 2733525 | 
		2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid | 
	 
	
		| 3033630 | 
		2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 3471 | Additional Members: 6 | Rows returned: 4 |  |   
 
 |