| Compound Information | SONAR Target prediction |  | Name: | CLOMIPHENE CITRATE |  | Unique Identifier: | SPE01500196  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 561.797 g/mol |  | X log p: | 30.354  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 12.47 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 9 |  | Canonical Smiles: | CCN(CC)CCOc1ccc(cc1)C(=C(Cl)c1ccccc1)c1ccccc1.OC(=O)CC(O)(CC(O)=O)C(O) =O |  | Source: | synthetic |  | Therapeutics: | gonad stimulating principle |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		AAT2 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.0685±0.00905097 | 
	 
	
		| Normalized OD Score: sc h | 
		0.0930±0.0119081 | 
	 
	
		| Z-Score: | 
		-48.1732±0.427145 | 
	 
	
		| p-Value: | 
		0 | 
	 
	
		| Z-Factor: | 
		0.8842 | 
	 
	
		| Fitness Defect: | 
		INF | 
	 
	
		| Bioactivity Statement: | 
		Toxic | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 5|D7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.70 Celcius |  | Date: | 2008-04-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.0402±0.00073 |  | Plate DMSO Control (-): | 0.7159±0.01647 |  | Plate Z-Factor: | 0.9139 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 3 |  |  
 
	
		| 60974 | 
		2-[4-(2-chloro-1,2-diphenyl-ethenyl)phenoxy]-N,N-diethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid | 
	 
	
		| 3033832 | 
		2-[4-[(E)-2-chloro-1,2-diphenyl-ethenyl]phenoxy]-N,N-diethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid | 
	 
	
		| 6420009 | 
		2-[4-[(E)-2-chloro-1,2-diphenyl-ethenyl]phenoxy]-N,N-diethyl-ethanamine; 2-hydroxypropane-1,2,3-tricarboxylic acid | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  nonactive | Cluster 3471 | Additional Members: 6 | Rows returned: 5 |  |   
 
 |