Compound Information | SONAR Target prediction | Name: | PROPAZINE | Unique Identifier: | SPE00330026 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 213.583 g/mol | X log p: | -0.879 (online calculus) | Lipinksi Failures | 0 | TPSA | 37.08 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)Nc1nc(Cl)nc(NC(C)C)n1 | Source: | synthetic | Therapeutics: | herbicide |
Species: |
4932 |
Condition: |
ARP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7043±0.0115966 |
Normalized OD Score: sc h |
1.0141±0.0070171 |
Z-Score: |
0.6980±0.299636 |
p-Value: |
0.494878 |
Z-Factor: |
-3.57711 |
Fitness Defect: |
0.7034 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 25|B9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.70 Celcius | Date: | 2006-03-23 YYYY-MM-DD | Plate CH Control (+): | 0.041124999999999995±0.00190 | Plate DMSO Control (-): | 0.677±0.01286 | Plate Z-Factor: | 0.9432 |
| png ps pdf |
2256 |
6-chloro-N--ethyl-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
4937 |
6-chloro-N,N--dipropan-2-yl-1,3,5-triazine-2,4-diamine |
18153 |
6-chloro-N--methyl-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
22206 |
6-chloro-N--ethyl-N-tert-butyl-1,3,5-triazine-2,4-diamine |
36755 |
6-chloro-N--methyl-N-tert-butyl-1,3,5-triazine-2,4-diamine |
134683 |
6-chloro-N--ethyl-N-propan-2-yl-1,3,5-triazine-2,4-diamine hydrochloride |
internal high similarity DBLink | Rows returned: 2 | |
active | Cluster 332 | Additional Members: 6 | Rows returned: 0 | |
|