| Compound Information | SONAR Target prediction | | Name: | PROPAZINE | | Unique Identifier: | SPE00330026 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 213.583 g/mol | | X log p: | -0.879 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 37.08 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | CC(C)Nc1nc(Cl)nc(NC(C)C)n1 | | Source: | synthetic | | Therapeutics: | herbicide |
| Species: |
4932 |
| Condition: |
ARP1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7043±0.0115966 |
| Normalized OD Score: sc h |
1.0141±0.0070171 |
| Z-Score: |
0.6980±0.299636 |
| p-Value: |
0.494878 |
| Z-Factor: |
-3.57711 |
| Fitness Defect: |
0.7034 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 25|B9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.70 Celcius | | Date: | 2006-03-23 YYYY-MM-DD | | Plate CH Control (+): | 0.041124999999999995±0.00190 | | Plate DMSO Control (-): | 0.677±0.01286 | | Plate Z-Factor: | 0.9432 |
|  png
ps
pdf |
| 2256 |
6-chloro-N--ethyl-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| 4937 |
6-chloro-N,N--dipropan-2-yl-1,3,5-triazine-2,4-diamine |
| 18153 |
6-chloro-N--methyl-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| 22206 |
6-chloro-N--ethyl-N-tert-butyl-1,3,5-triazine-2,4-diamine |
| 36755 |
6-chloro-N--methyl-N-tert-butyl-1,3,5-triazine-2,4-diamine |
| 134683 |
6-chloro-N--ethyl-N-propan-2-yl-1,3,5-triazine-2,4-diamine hydrochloride |
| internal high similarity DBLink | Rows returned: 2 | |
| active | Cluster 332 | Additional Members: 6 | Rows returned: 0 | |
|
