| Compound Information | SONAR Target prediction |
| Name: | PIMPINELLIN |
| Unique Identifier: | SPE00300013 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | |
| Molecular Weight: | 236.136 g/mol |
| X log p: | 9.524 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 53.99 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 5 |
| Rotatable Bond Count: | 2 |
| Canonical Smiles: | COc1c(OC)c2C=CC(=O)Oc2c2ccoc12 |
| Class: | coumarin |
| Source: | Heracleum maximum root; mp 118-119 C |
| Reference: | Monatsh 59: 161 (1932); J Org Chem 35: 2294 (1970) |
| Therapeutics: | GABA receptor antagonist, phototoxin |
| Found: 17 active | as graph: single | with analogs | 1 2 3 4 5 6 7 8 9 10 Next >> |
| Species: | 4932 |
| Condition: | ARF1 |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5812±0.0206475 |
| Normalized OD Score: sc h | 0.8659±0.0100529 |
| Z-Score: | -6.4994±0.508405 |
| p-Value: | 0.000000000416428 |
| Z-Factor: | -0.735065 |
| Fitness Defect: | 21.5993 |
| Bioactivity Statement: | Active |
| ps |
| DBLink | Rows returned: 1 |
| 4825 |
| internal high similarity DBLink | Rows returned: 2 |
| SPE00300005 | 0.9179 |
| SPE00300012 | 0.9640 |
| active | Cluster 15649 | Additional Members: 2 | Rows returned: 1 |
| SPE00300032 | 0 |
Service provided by the
Mike Tyers Laboratory