| 
 | Compound Information | SONAR Target prediction |  | Name: | METHYL DEOXYCHOLATE |  | Unique Identifier: | SPE00270051 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 364.265 g/mol |  | X log p: | -0.0670000000000001  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C |  | Class: | sterol |  | Source: | rabbit bile & feces |  | Reference: | Helv Chim Acta 25:797 (1942); J Biol Chem 238: 3846 (1963) |  | Generic_name: | METHYL NONANOATE (ESTER) |  | Chemical_iupac_name: | METHYL NONANOATE (ESTER) |  | Drug_type: | Experimental |  | Drugbank_id: | EXPT02376 |  | Drug_category: | Neutrophil Gelatinase inhibitor |  | Organisms_affected: | -1 | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BY4741-2nd |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.8790±0 |  
		| Normalized OD Score: sc h | 0.8997±0 |  
		| Z-Score: | -4.0518±0 |  
		| p-Value: | 0.0000508152 |  
		| Z-Factor: | -0.640497 |  
		| Fitness Defect: | 9.8873 |  
		| Bioactivity Statement: | Active |  | | Experimental Conditions |  |  | Library: | Spectrum_ED |  | Plate Number and Position: | 16|H3 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 595 nm |  | Robot Temperature: | 30.00 Celcius |  | Date: | 2012-05-28 YYYY-MM-DD |  | Plate CH Control (+): | 0.0985±0.00655 |  | Plate DMSO Control (-): | 0.9555±0.04473 |  | Plate Z-Factor: | 0.8205 | 
 |  png ps
 pdf
 | 
 
 
	
		| 639452 | methyl (1S,3S,8S)-2-methyl-7-oxo-bicyclo[6.4.0]dodecane-3-carboxylate |  
		| 640673 | methyl (2S)-2-[(1S,4R,4aS,7S,8aS)-7-hydroxy-4-methyl-decalin-1-yl]propanoate |  
		| 642258 | methyl (6R)-2,2,6-trimethylnonanoate |  
		| 642259 | methyl (4S)-2,2,4-trimethylheptanoate |  
		| 642261 | methyl (4R,6R)-2,2,4,6-tetramethylnonanoate |  
		| 642263 | methyl 2,2,6,6,8-pentamethylnonanoate |  
 | internal high similarity DBLink  | Rows returned: 7 | 1 2 Next >> | 
 
 | active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 |  | 
 
 |