Compound Information | SONAR Target prediction | Name: | METHYL DEOXYCHOLATE | Unique Identifier: | SPE00270051 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 364.265 g/mol | X log p: | -0.0670000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 5 | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C | Class: | sterol | Source: | rabbit bile & feces | Reference: | Helv Chim Acta 25:797 (1942); J Biol Chem 238: 3846 (1963) | Generic_name: | METHYL NONANOATE (ESTER) | Chemical_iupac_name: | METHYL NONANOATE (ESTER) | Drug_type: | Experimental | Drugbank_id: | EXPT02376 | Drug_category: | Neutrophil Gelatinase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
BEM2 |
Replicates: |
2 |
Raw OD Value: r im |
0.3559±0.0277893 |
Normalized OD Score: sc h |
0.7464±0.0464609 |
Z-Score: |
-7.4478±1.2479 |
p-Value: |
0.0000000000259504 |
Z-Factor: |
0.0441255 |
Fitness Defect: |
24.3748 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|E6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.30 Celcius | Date: | 2008-02-05 YYYY-MM-DD | Plate CH Control (+): | 0.040999999999999995±0.00049 | Plate DMSO Control (-): | 0.479475±0.01495 | Plate Z-Factor: | 0.9007 |
| png ps pdf |
627807 |
methyl 2,4a,8a-trimethyl-8-oxo-1,3,4,4b,5,6,7,9,10,10a-decahydrophenanthrene-2-carboxylate |
628441 |
methyl 14-methyloctadecanoate |
630636 |
n/a |
631815 |
dimethyl 2,3,4,5-tetrahexylhexanedioate |
633043 |
methyl 4-(10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pen tanoate |
633582 |
n/a |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 | |
|