Compound Information | SONAR Target prediction | Name: | METHYL DEOXYCHOLATE | Unique Identifier: | SPE00270051 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 364.265 g/mol | X log p: | -0.0670000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 5 | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C | Class: | sterol | Source: | rabbit bile & feces | Reference: | Helv Chim Acta 25:797 (1942); J Biol Chem 238: 3846 (1963) | Generic_name: | METHYL NONANOATE (ESTER) | Chemical_iupac_name: | METHYL NONANOATE (ESTER) | Drug_type: | Experimental | Drugbank_id: | EXPT02376 | Drug_category: | Neutrophil Gelatinase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
MT2481-pdr1pdr3 |
Replicates: |
2 |
Raw OD Value: r im |
0.0453±0.000424264 |
Normalized OD Score: sc h |
0.0680±0.000692205 |
Z-Score: |
-29.5953±0.665888 |
p-Value: |
0 |
Z-Factor: |
0.928272 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|C11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.30 Celcius | Date: | 2006-05-02 YYYY-MM-DD | Plate CH Control (+): | 0.03805±0.00500 | Plate DMSO Control (-): | 0.676425±0.01453 | Plate Z-Factor: | 0.8841 |
| png ps pdf |
593120 |
methyl 9-hydroxypentadecanoate |
593159 |
methyl 9-hydroxyoctadecanoate |
594080 |
methyl 6-oxooctadecanoate |
595862 |
methyl 7-ethyl-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
597132 |
dimethyl bicyclo[3.2.1]octane-2,6-dicarboxylate |
597417 |
methyl 2-(1,5,5,8-tetramethyl-9-bicyclo[4.2.1]nonyl)acetate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 | |
|