Compound Information | SONAR Target prediction | Name: | METHYL DEOXYCHOLATE | Unique Identifier: | SPE00270051 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 364.265 g/mol | X log p: | -0.0670000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 5 | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C | Class: | sterol | Source: | rabbit bile & feces | Reference: | Helv Chim Acta 25:797 (1942); J Biol Chem 238: 3846 (1963) | Generic_name: | METHYL NONANOATE (ESTER) | Chemical_iupac_name: | METHYL NONANOATE (ESTER) | Drug_type: | Experimental | Drugbank_id: | EXPT02376 | Drug_category: | Neutrophil Gelatinase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SER1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5132±0.0239709 |
Normalized OD Score: sc h |
0.8534±0.0327331 |
Z-Score: |
-4.6351±1.15832 |
p-Value: |
0.000067826 |
Z-Factor: |
-1.71709 |
Fitness Defect: |
9.5986 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 6|C11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.60 Celcius | Date: | 2007-09-17 YYYY-MM-DD | Plate CH Control (+): | 0.039625±0.00045 | Plate DMSO Control (-): | 0.596725±0.04883 | Plate Z-Factor: | 0.7514 |
| png ps pdf |
568121 |
methyl 3,20,20-trimethylhenicosanoate |
568130 |
methyl 7-hydroxy-3,7-dimethyl-octanoate |
568163 |
methyl 3,7,11,15-tetramethylhexadecanoate |
568164 |
methyl 3,7,11-trimethyldodecanoate |
568165 |
methyl 3,6-dimethyltetracosanoate |
568166 |
methyl 3,5-dimethyltricosanoate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 | |
|