| Compound Information | SONAR Target prediction | | Name: | METHYL DEOXYCHOLATE | | Unique Identifier: | SPE00270051 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 364.265 g/mol | | X log p: | -0.0670000000000001 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C | | Class: | sterol | | Source: | rabbit bile & feces | | Reference: | Helv Chim Acta 25:797 (1942); J Biol Chem 238: 3846 (1963) | | Generic_name: | METHYL NONANOATE (ESTER) | | Chemical_iupac_name: | METHYL NONANOATE (ESTER) | | Drug_type: | Experimental | | Drugbank_id: | EXPT02376 | | Drug_category: | Neutrophil Gelatinase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
FKS1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.4522±0.0495682 |
| Normalized OD Score: sc h |
0.6987±0.0630217 |
| Z-Score: |
-13.1799±2.29406 |
| p-Value: |
3.37362e-31 |
| Z-Factor: |
0.19388 |
| Fitness Defect: |
70.1642 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 9|E6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.80 Celcius | | Date: | 2008-06-04 YYYY-MM-DD | | Plate CH Control (+): | 0.040325±0.00070 | | Plate DMSO Control (-): | 0.635175±0.01139 | | Plate Z-Factor: | 0.9418 |
| png ps pdf |
| 560227 |
dimethyl 2-octylnonanedioate |
| 560249 |
methyl 4,8,12,16-tetramethylheptadecanoate |
| 560252 |
methyl 2,9-dimethyltetracosanoate |
| 560261 |
methyl 2,4,6-trimethylundecanoate |
| 560276 |
methyl 2,6,10-trimethyltridecanoate |
| 560278 |
methyl 2-methylhexacosanoate |
| internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
| active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 | |
|