| Compound Information | SONAR Target prediction |  | Name: | METHYL DEOXYCHOLATE |  | Unique Identifier: | SPE00270051  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 364.265 g/mol |  | X log p: | -0.0670000000000001  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 26.3 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 5 |  | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C |  | Class: | sterol |  | Source: | rabbit bile & feces |  | Reference: | Helv Chim Acta 25:797 (1942); J Biol Chem 238: 3846 (1963) |  | Generic_name: | METHYL NONANOATE (ESTER) |  | Chemical_iupac_name: | METHYL NONANOATE (ESTER) |  | Drug_type: | Experimental |  | Drugbank_id: | EXPT02376 |  | Drug_category: | Neutrophil Gelatinase inhibitor |  | Organisms_affected: | -1 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		BCK1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5003±0.0147078 | 
	 
	
		| Normalized OD Score: sc h | 
		0.8462±0.0206107 | 
	 
	
		| Z-Score: | 
		-6.7976±1.21133 | 
	 
	
		| p-Value: | 
		0.00000000141598 | 
	 
	
		| Z-Factor: | 
		0.0796161 | 
	 
	
		| Fitness Defect: | 
		20.3754 | 
	 
	
		| Bioactivity Statement: | 
		Active | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 6|C11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.00 Celcius |  | Date: | 2006-03-24 YYYY-MM-DD |  | Plate CH Control (+): | 0.038424999999999994±0.00113 |  | Plate DMSO Control (-): | 0.654025±0.02504 |  | Plate Z-Factor: | 0.8488 |  
  |  png ps pdf |  
 
 
	
		| 560153 | 
		methyl 4-methyloctadecanoate | 
	 
	
		| 560154 | 
		methyl 4,6-dimethyloctanoate | 
	 
	
		| 560155 | 
		methyl 4,8,12-trimethyltridecanoate | 
	 
	
		| 560158 | 
		methyl 4,8-dimethylnonanoate | 
	 
	
		| 560171 | 
		methyl 4,6-dimethylnonanoate | 
	 
	
		| 560217 | 
		dimethyl 2-hexyltridecanedioate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 7 | 1 2 Next >>  |   
 |  active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 |  |   
 
 |