| Compound Information | SONAR Target prediction | | Name: | METHYL DEOXYCHOLATE | | Unique Identifier: | SPE00270051 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 364.265 g/mol | | X log p: | -0.0670000000000001 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C | | Class: | sterol | | Source: | rabbit bile & feces | | Reference: | Helv Chim Acta 25:797 (1942); J Biol Chem 238: 3846 (1963) | | Generic_name: | METHYL NONANOATE (ESTER) | | Chemical_iupac_name: | METHYL NONANOATE (ESTER) | | Drug_type: | Experimental | | Drugbank_id: | EXPT02376 | | Drug_category: | Neutrophil Gelatinase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
BCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5003±0.0147078 |
| Normalized OD Score: sc h |
0.8462±0.0206107 |
| Z-Score: |
-6.7976±1.21133 |
| p-Value: |
0.00000000141598 |
| Z-Factor: |
0.0796161 |
| Fitness Defect: |
20.3754 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 6|C11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.00 Celcius | | Date: | 2006-03-24 YYYY-MM-DD | | Plate CH Control (+): | 0.038424999999999994±0.00113 | | Plate DMSO Control (-): | 0.654025±0.02504 | | Plate Z-Factor: | 0.8488 |
| png ps pdf |
| 544484 |
methyl 4-(3-oxo-1,2,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthren-17-yl)pentanoate |
| 545548 |
methyl 2-ethyl-2-propyl-hexanoate |
| 545640 |
methyl 34,36-dimethyloctatriacontanoate |
| 545641 |
methyl 10,14,18,22-tetramethyltricosanoate |
| 545665 |
methyl 5-ethyl-3,5,9-trimethyl-decanoate |
| 545745 |
methyl 8-(2-octanoylcyclopropyl)octanoate |
| internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
|