Compound Information | SONAR Target prediction | Name: | METHYL DEOXYCHOLATE | Unique Identifier: | SPE00270051 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 364.265 g/mol | X log p: | -0.0670000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 5 | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C | Class: | sterol | Source: | rabbit bile & feces | Reference: | Helv Chim Acta 25:797 (1942); J Biol Chem 238: 3846 (1963) | Generic_name: | METHYL NONANOATE (ESTER) | Chemical_iupac_name: | METHYL NONANOATE (ESTER) | Drug_type: | Experimental | Drugbank_id: | EXPT02376 | Drug_category: | Neutrophil Gelatinase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
MT2481-pdr1pdr3-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.0429±0.000989949 |
Normalized OD Score: sc h |
0.0885±0.00174492 |
Z-Score: |
-39.6042±1.90326 |
p-Value: |
0 |
Z-Factor: |
0.135018 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|E6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.80 Celcius | Date: | 2008-08-22 YYYY-MM-DD | Plate CH Control (+): | 0.040124999999999994±0.00055 | Plate DMSO Control (-): | 0.5677500000000001±0.00837 | Plate Z-Factor: | 0.9501 |
| png ps pdf |
544208 |
1,5,13-trimethyl tridecane-1,5,13-tricarboxylate |
544220 |
1,6,14-trimethyl 1-methyltetradecane-1,6,14-tricarboxylate |
544345 |
dimethyl 3,6,9,12-tetramethyltetradecanedioate |
544392 |
methyl 9-[2-[(2-butylcyclopropyl)methyl]cyclopropyl]nonanoate |
544454 |
dimethyl 9-oxoheptadecanedioate |
544455 |
dimethyl 9-oxooctadecanedioate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 | |
|