| Compound Information | SONAR Target prediction | | Name: | METHYL DEOXYCHOLATE | | Unique Identifier: | SPE00270051 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 364.265 g/mol | | X log p: | -0.0670000000000001 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C | | Class: | sterol | | Source: | rabbit bile & feces | | Reference: | Helv Chim Acta 25:797 (1942); J Biol Chem 238: 3846 (1963) | | Generic_name: | METHYL NONANOATE (ESTER) | | Chemical_iupac_name: | METHYL NONANOATE (ESTER) | | Drug_type: | Experimental | | Drugbank_id: | EXPT02376 | | Drug_category: | Neutrophil Gelatinase inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
CHS3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5982±0.0103945 |
| Normalized OD Score: sc h |
0.9085±0.0132721 |
| Z-Score: |
-4.2269±0.512724 |
| p-Value: |
0.0000579204 |
| Z-Factor: |
-0.427886 |
| Fitness Defect: |
9.7564 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 9|E6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.50 Celcius | | Date: | 2008-06-20 YYYY-MM-DD | | Plate CH Control (+): | 0.040925±0.00049 | | Plate DMSO Control (-): | 0.654575±0.01874 | | Plate Z-Factor: | 0.9063 |
|  png
ps
pdf |
| 338441 |
n/a |
| 347361 |
22-methoxy-22-oxo-docosanoic acid |
| 348031 |
methyl
3-(2-acetyl-2,4b,6a,9,9,10b,12a-heptamethyl-1,3,4,4a,5,6,7,8,10,10a,11,12-dodecahydrochrysen-1-yl)propan
oate |
| 348822 |
methyl 10-methyl-11-oxo-dodecanoate |
| 369179 |
n/a |
| 370494 |
methyl
4-[(5R)-3-(hydroxymethyl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[
a]phenanthren-17-yl]pentanoate |
| internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
| active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 | |
|
