Compound Information | SONAR Target prediction | Name: | METHYL DEOXYCHOLATE | Unique Identifier: | SPE00270051 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 364.265 g/mol | X log p: | -0.0670000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 5 | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C | Class: | sterol | Source: | rabbit bile & feces | Reference: | Helv Chim Acta 25:797 (1942); J Biol Chem 238: 3846 (1963) | Generic_name: | METHYL NONANOATE (ESTER) | Chemical_iupac_name: | METHYL NONANOATE (ESTER) | Drug_type: | Experimental | Drugbank_id: | EXPT02376 | Drug_category: | Neutrophil Gelatinase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
REF2 |
Replicates: |
2 |
Raw OD Value: r im |
0.3441±0.0576999 |
Normalized OD Score: sc h |
0.8018±0.00809063 |
Z-Score: |
-5.7174±0.179801 |
p-Value: |
0.0000000138768 |
Z-Factor: |
0.345864 |
Fitness Defect: |
18.093 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|E6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.50 Celcius | Date: | 2008-08-27 YYYY-MM-DD | Plate CH Control (+): | 0.04185±0.00075 | Plate DMSO Control (-): | 0.40549999999999997±0.01414 | Plate Z-Factor: | 0.8563 |
| png ps pdf |
280076 |
methyl 3,3-dimethyl-2-(3-oxobutyl)cyclobutane-1-carboxylate |
281271 |
methyl 6-[4-(2-methoxycarbonylethyl)cyclohexyl]hexanoate |
282300 |
methyl 10-hydroxyoctadecanoate |
283665 |
methyl 4a,8-dimethyl-7-oxo-decalin-2-carboxylate |
284195 |
methyl 17-ethyl-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthrene-17-carb oxylate |
288022 |
methyl 6-oxoheptanoate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 | |
|