Compound Information | SONAR Target prediction | Name: | METHYL DEOXYCHOLATE | Unique Identifier: | SPE00270051 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 364.265 g/mol | X log p: | -0.0670000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 5 | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C | Class: | sterol | Source: | rabbit bile & feces | Reference: | Helv Chim Acta 25:797 (1942); J Biol Chem 238: 3846 (1963) | Generic_name: | METHYL NONANOATE (ESTER) | Chemical_iupac_name: | METHYL NONANOATE (ESTER) | Drug_type: | Experimental | Drugbank_id: | EXPT02376 | Drug_category: | Neutrophil Gelatinase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
SKT5 |
Replicates: |
2 |
Raw OD Value: r im |
0.6138±0.0222032 |
Normalized OD Score: sc h |
0.8996±0.0313487 |
Z-Score: |
-4.9970±1.58472 |
p-Value: |
0.0000530068 |
Z-Factor: |
-0.457079 |
Fitness Defect: |
9.8451 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|E6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.80 Celcius | Date: | 2008-06-17 YYYY-MM-DD | Plate CH Control (+): | 0.040525000000000005±0.00041 | Plate DMSO Control (-): | 0.6823999999999999±0.01173 | Plate Z-Factor: | 0.9330 |
| png ps pdf |
271887 |
methyl 22-hydroxytetracosanoate |
272802 |
methyl 2-(2-methoxycarbonylethyl)-2,3,4-trimethyl-cyclohexane-1-carboxylate |
274511 |
n/a |
277460 |
methyl 2-methyl-4-(1,4,4-trimethyl-2-oxo-cycloheptyl)butanoate |
279054 |
methyl 6-(hydroxymethyl)-1,4a-dimethyl-7-propan-2-yl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-1-car boxylate |
280074 |
methyl 1,4a-dimethyl-2,3,4,4b,5,6,7,8,8a,9,10,10a-dodecahydrophenanthrene-1-carboxylate |
internal high similarity DBLink | Rows returned: 7 | 1 2 Next >> |
active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 | |
|