Compound Information | SONAR Target prediction | Name: | METHYL DEOXYCHOLATE | Unique Identifier: | SPE00270051 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 364.265 g/mol | X log p: | -0.0670000000000001 (online calculus) | Lipinksi Failures | 0 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 5 | Canonical Smiles: | COC(=O)CCC(C)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C | Class: | sterol | Source: | rabbit bile & feces | Reference: | Helv Chim Acta 25:797 (1942); J Biol Chem 238: 3846 (1963) | Generic_name: | METHYL NONANOATE (ESTER) | Chemical_iupac_name: | METHYL NONANOATE (ESTER) | Drug_type: | Experimental | Drugbank_id: | EXPT02376 | Drug_category: | Neutrophil Gelatinase inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
ARL3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6145±0.0270115 |
Normalized OD Score: sc h |
0.9128±0.0188145 |
Z-Score: |
-4.1015±0.731366 |
p-Value: |
0.000170904 |
Z-Factor: |
-0.347241 |
Fitness Defect: |
8.6744 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|E6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.50 Celcius | Date: | 2008-06-11 YYYY-MM-DD | Plate CH Control (+): | 0.03995±0.00044 | Plate DMSO Control (-): | 0.6753±0.01421 | Plate Z-Factor: | 0.9468 |
| png ps pdf |
7173421 |
methyl (4S)-4-[(5S,8R,9R,10S,12S,13R,14R,17R)-12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetra decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
7173422 |
methyl (4S)-4-[(5S,8R,9S,10S,12S,13R,14S,17R)-12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetra decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
7173424 |
methyl (4S)-4-[(5S,8R,9S,10S,12S,13R,14R,17R)-12-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetra decahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
7173429 |
(3R,5S,8R,9R,10S,12S,13R,14S,17R)-17-[(2S)-4-methoxycarbonylbutan-2-yl]-10,13-dimethyl-7-oxo-1,2,3,4,5,6 ,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,12-dicarboxylate |
7173430 |
(3R,5S,8R,9R,10S,12S,13R,14S,17R)-17-[(2S)-4-methoxycarbonylbutan-2-yl]-10,13-dimethyl-7-oxo-1,2,3,4,5,6 ,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,12-dicarboxylic acid |
7173431 |
(3R,5S,8R,9R,10S,12S,13R,14R,17R)-17-[(2S)-4-methoxycarbonylbutan-2-yl]-10,13-dimethyl-7-oxo-1,2,3,4,5,6 ,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,12-dicarboxylate |
internal high similarity DBLink | Rows returned: 7 | << Back 1 2 |
active | Cluster 2228 | Additional Members: 18 | Rows returned: 6 | |
|